C20H20F3N3O6 — CID 40782990
(4S,5S,6R)-4-hydroxy-5-(pyridine-3-carbonyl)-4-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)-1,3-diazinan-2-one (PubChem CID 40782990) has the molecular formula C20H20F3N3O6 and a molecular weight of 455.39 g/mol. Its IUPAC name is (4S,5S,6R)-4-hydroxy-5-(pyridine-3-carbonyl)-4-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)-1,3-diazinan-2-one.
| Compound Name | (4S,5S,6R)-4-hydroxy-5-(pyridine-3-carbonyl)-4-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 40782990 |
| Molecular Formula | C20H20F3N3O6 |
| Molecular Weight | 455.39 g/mol |
| Exact Mass | 455.13 |
| IUPAC Name | (4S,5S,6R)-4-hydroxy-5-(pyridine-3-carbonyl)-4-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)-1,3-diazinan-2-one |
| SMILES | COc1cc(C2NC(=O)N[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2cccnc2)cc(OC)c1OC |
| InChI | InChI=1S/C20H20F3N3O6/c1-30-12-7-11(8-13(31-2)17(12)32-3)15-14(16(27)10-5-4-6-24-9-10)19(29,20(21,22)23)26-18(28)25-15/h4-9,14-15,29H,1-3H3,(H2,25,26,28)/t14-,15?,19+/m1/s1 |
| InChIKey | WHJGKYMUZBYMGY-PBIBAUFZSA-N |
| XLogP | 2.21 |
| TPSA | 119.01 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.39 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |