C19H19F3N2O6S — CID 1415411
(4R,5R,6S)-4-hydroxy-5-(thiophene-2-carbonyl)-4-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)-1,3-diazinan-2-one (PubChem CID 1415411) has the molecular formula C19H19F3N2O6S and a molecular weight of 460.43 g/mol. Its IUPAC name is (4R,5R,6S)-4-hydroxy-5-(thiophene-2-carbonyl)-4-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)-1,3-diazinan-2-one.
| Compound Name | (4R,5R,6S)-4-hydroxy-5-(thiophene-2-carbonyl)-4-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 1415411 |
| Molecular Formula | C19H19F3N2O6S |
| Molecular Weight | 460.43 g/mol |
| Exact Mass | 460.09 |
| IUPAC Name | (4R,5R,6S)-4-hydroxy-5-(thiophene-2-carbonyl)-4-(trifluoromethyl)-6-(3,4,5-trimethoxyphenyl)-1,3-diazinan-2-one |
| SMILES | COc1cc(C2NC(=O)N[C@](O)(C(F)(F)F)[C@@H]2C(=O)c2cccs2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19F3N2O6S/c1-28-10-7-9(8-11(29-2)16(10)30-3)14-13(15(25)12-5-4-6-31-12)18(27,19(20,21)22)24-17(26)23-14/h4-8,13-14,27H,1-3H3,(H2,23,24,26)/t13-,14?,18+/m0/s1 |
| InChIKey | FXBXTDPHFFHMSE-IXRXBBNISA-N |
| XLogP | 2.88 |
| TPSA | 106.12 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.43 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |