C20H21F3N2O6S — CID 93286368
(4R,5S,6S)-6-hydroxy-1-methyl-5-(thiophene-2-carbonyl)-6-(trifluoromethyl)-4-(3,4,5-trimethoxyphenyl)-1,3-diazinan-2-one (PubChem CID 93286368) has the molecular formula C20H21F3N2O6S and a molecular weight of 474.46 g/mol. Its IUPAC name is (4R,5S,6S)-6-hydroxy-1-methyl-5-(thiophene-2-carbonyl)-6-(trifluoromethyl)-4-(3,4,5-trimethoxyphenyl)-1,3-diazinan-2-one.
| Compound Name | (4R,5S,6S)-6-hydroxy-1-methyl-5-(thiophene-2-carbonyl)-6-(trifluoromethyl)-4-(3,4,5-trimethoxyphenyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 93286368 |
| Molecular Formula | C20H21F3N2O6S |
| Molecular Weight | 474.46 g/mol |
| Exact Mass | 474.11 |
| IUPAC Name | (4R,5S,6S)-6-hydroxy-1-methyl-5-(thiophene-2-carbonyl)-6-(trifluoromethyl)-4-(3,4,5-trimethoxyphenyl)-1,3-diazinan-2-one |
| SMILES | COc1cc(C2NC(=O)N(C)[C@@](O)(C(F)(F)F)[C@H]2C(=O)c2cccs2)cc(OC)c1OC |
| InChI | InChI=1S/C20H21F3N2O6S/c1-25-18(27)24-15(10-8-11(29-2)17(31-4)12(9-10)30-3)14(19(25,28)20(21,22)23)16(26)13-6-5-7-32-13/h5-9,14-15,28H,1-4H3,(H,24,27)/t14-,15?,19+/m1/s1 |
| InChIKey | HOYVBGVMYNTZLL-PBIBAUFZSA-N |
| XLogP | 3.22 |
| TPSA | 97.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.46 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |