C16H13F3N2O5S — CID 92521114
(4S,5R,6S)-6-(3,4-dihydroxyphenyl)-4-hydroxy-5-(thiophene-2-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one (PubChem CID 92521114) has the molecular formula C16H13F3N2O5S and a molecular weight of 402.35 g/mol. Its IUPAC name is (4S,5R,6S)-6-(3,4-dihydroxyphenyl)-4-hydroxy-5-(thiophene-2-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one.
| Compound Name | (4S,5R,6S)-6-(3,4-dihydroxyphenyl)-4-hydroxy-5-(thiophene-2-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 92521114 |
| Molecular Formula | C16H13F3N2O5S |
| Molecular Weight | 402.35 g/mol |
| Exact Mass | 402.05 |
| IUPAC Name | (4S,5R,6S)-6-(3,4-dihydroxyphenyl)-4-hydroxy-5-(thiophene-2-carbonyl)-4-(trifluoromethyl)-1,3-diazinan-2-one |
| SMILES | O=C1NC(c2ccc(O)c(O)c2)[C@@H](C(=O)c2cccs2)[C@](O)(C(F)(F)F)N1 |
| InChI | InChI=1S/C16H13F3N2O5S/c17-16(18,19)15(26)11(13(24)10-2-1-5-27-10)12(20-14(25)21-15)7-3-4-8(22)9(23)6-7/h1-6,11-12,22-23,26H,(H2,20,21,25)/t11-,12?,15-/m0/s1 |
| InChIKey | NJGREJILWMBXGP-BQELKBSMSA-N |
| XLogP | 2.26 |
| TPSA | 118.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.35 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'} |
|---|