C18H13ClF3N3O5 — CID 98133160
(4R,5R,6S)-5-(4-chlorobenzoyl)-4-hydroxy-6-(3-nitrophenyl)-4-(trifluoromethyl)-1,3-diazinan-2-one (PubChem CID 98133160) has the molecular formula C18H13ClF3N3O5 and a molecular weight of 443.77 g/mol. Its IUPAC name is (4R,5R,6S)-5-(4-chlorobenzoyl)-4-hydroxy-6-(3-nitrophenyl)-4-(trifluoromethyl)-1,3-diazinan-2-one.
| Compound Name | (4R,5R,6S)-5-(4-chlorobenzoyl)-4-hydroxy-6-(3-nitrophenyl)-4-(trifluoromethyl)-1,3-diazinan-2-one |
|---|---|
| PubChem CID | 98133160 |
| Molecular Formula | C18H13ClF3N3O5 |
| Molecular Weight | 443.77 g/mol |
| Exact Mass | 443.05 |
| IUPAC Name | (4R,5R,6S)-5-(4-chlorobenzoyl)-4-hydroxy-6-(3-nitrophenyl)-4-(trifluoromethyl)-1,3-diazinan-2-one |
| SMILES | O=C1NC(c2cccc([N+](=O)[O-])c2)[C@@H](C(=O)c2ccc(Cl)cc2)[C@@](O)(C(F)(F)F)N1 |
| InChI | InChI=1S/C18H13ClF3N3O5/c19-11-6-4-9(5-7-11)15(26)13-14(10-2-1-3-12(8-10)25(29)30)23-16(27)24-17(13,28)18(20,21)22/h1-8,13-14,28H,(H2,23,24,27)/t13-,14?,17+/m0/s1 |
| InChIKey | OHQJZGUTAFDIPH-BHVXPOTESA-N |
| XLogP | 3.35 |
| TPSA | 121.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.77 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|