C29H18O8 — CID 71608632
(3S,4S)-3-(2-hydroxybenzoyl)-4-(6-methyl-4-oxochromen-3-yl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione (PubChem CID 71608632) has the molecular formula C29H18O8 and a molecular weight of 494.46 g/mol. Its IUPAC name is (3S,4S)-3-(2-hydroxybenzoyl)-4-(6-methyl-4-oxochromen-3-yl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione.
| Compound Name | (3S,4S)-3-(2-hydroxybenzoyl)-4-(6-methyl-4-oxochromen-3-yl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione |
|---|---|
| PubChem CID | 71608632 |
| Molecular Formula | C29H18O8 |
| Molecular Weight | 494.46 g/mol |
| Exact Mass | 494.10 |
| IUPAC Name | (3S,4S)-3-(2-hydroxybenzoyl)-4-(6-methyl-4-oxochromen-3-yl)-3,4-dihydropyrano[3,2-c]chromene-2,5-dione |
| SMILES | Cc1ccc2occ([C@H]3c4c(c5ccccc5oc4=O)OC(=O)[C@@H]3C(=O)c3ccccc3O)c(=O)c2c1 |
| InChI | InChI=1S/C29H18O8/c1-14-10-11-20-17(12-14)25(31)18(13-35-20)22-23(26(32)15-6-2-4-8-19(15)30)28(33)37-27-16-7-3-5-9-21(16)36-29(34)24(22)27/h2-13,22-23,30H,1H3/t22-,23+/m1/s1 |
| InChIKey | AEHIPUGUNNLIBY-PKTZIBPZSA-N |
| XLogP | 4.46 |
| TPSA | 124.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 37 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.46 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'cumarine', 'substructure': 'N/A'} |
|---|