C18H11NO5 — CID 132988261
2,3-dihydroxy-12H-[1,3]benzodioxolo[5,6-c]phenanthridin-13-one (PubChem CID 132988261) has the molecular formula C18H11NO5 and a molecular weight of 321.29 g/mol. Its IUPAC name is 2,3-dihydroxy-12H-[1,3]benzodioxolo[5,6-c]phenanthridin-13-one.
| Compound Name | 2,3-dihydroxy-12H-[1,3]benzodioxolo[5,6-c]phenanthridin-13-one |
|---|---|
| PubChem CID | 132988261 |
| Molecular Formula | C18H11NO5 |
| Molecular Weight | 321.29 g/mol |
| Exact Mass | 321.06 |
| IUPAC Name | 2,3-dihydroxy-12H-[1,3]benzodioxolo[5,6-c]phenanthridin-13-one |
| SMILES | O=c1[nH]c2c3cc4c(cc3ccc2c2cc(O)c(O)cc12)OCO4 |
| InChI | InChI=1S/C18H11NO5/c20-13-4-11-9-2-1-8-3-15-16(24-7-23-15)6-10(8)17(9)19-18(22)12(11)5-14(13)21/h1-6,20-21H,7H2,(H,19,22) |
| InChIKey | MVKJGDVWUACEIG-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 91.78 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.29 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|