C9H7N3O3S — CID 53367116
7-amino-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-8-one (PubChem CID 53367116) has the molecular formula C9H7N3O3S and a molecular weight of 237.24 g/mol. Its IUPAC name is 7-amino-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-8-one.
| Compound Name | 7-amino-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-8-one |
|---|---|
| PubChem CID | 53367116 |
| Molecular Formula | C9H7N3O3S |
| Molecular Weight | 237.24 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 7-amino-6-sulfanylidene-5H-[1,3]dioxolo[4,5-g]quinazolin-8-one |
| SMILES | Nn1c(=S)[nH]c2cc3c(cc2c1=O)OCO3 |
| InChI | InChI=1S/C9H7N3O3S/c10-12-8(13)4-1-6-7(15-3-14-6)2-5(4)11-9(12)16/h1-2H,3,10H2,(H,11,16) |
| InChIKey | XGRSNPIYXXMRPD-UHFFFAOYSA-N |
| XLogP | 0.50 |
| TPSA | 82.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.24 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|