C14H15NO3 — CID 62914777
6-methyl-7-propan-2-yl-5H-[1,3]dioxolo[4,5-g]quinolin-8-one (PubChem CID 62914777) has the molecular formula C14H15NO3 and a molecular weight of 245.28 g/mol. Its IUPAC name is 6-methyl-7-propan-2-yl-5H-[1,3]dioxolo[4,5-g]quinolin-8-one.
| Compound Name | 6-methyl-7-propan-2-yl-5H-[1,3]dioxolo[4,5-g]quinolin-8-one |
|---|---|
| PubChem CID | 62914777 |
| Molecular Formula | C14H15NO3 |
| Molecular Weight | 245.28 g/mol |
| Exact Mass | 245.11 |
| IUPAC Name | 6-methyl-7-propan-2-yl-5H-[1,3]dioxolo[4,5-g]quinolin-8-one |
| SMILES | Cc1[nH]c2cc3c(cc2c(=O)c1C(C)C)OCO3 |
| InChI | InChI=1S/C14H15NO3/c1-7(2)13-8(3)15-10-5-12-11(17-6-18-12)4-9(10)14(13)16/h4-5,7H,6H2,1-3H3,(H,15,16) |
| InChIKey | AWEATALPBYJDPA-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.28 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |