C13H16N2O2 — CID 82495723
1-(6-methyl-5H-[1,3]dioxolo[4,5-f]indol-7-yl)propan-2-amine (PubChem CID 82495723) has the molecular formula C13H16N2O2 and a molecular weight of 232.28 g/mol. Its IUPAC name is 1-(6-methyl-5H-[1,3]dioxolo[4,5-f]indol-7-yl)propan-2-amine.
| Compound Name | 1-(6-methyl-5H-[1,3]dioxolo[4,5-f]indol-7-yl)propan-2-amine |
|---|---|
| PubChem CID | 82495723 |
| Molecular Formula | C13H16N2O2 |
| Molecular Weight | 232.28 g/mol |
| Exact Mass | 232.12 |
| IUPAC Name | 1-(6-methyl-5H-[1,3]dioxolo[4,5-f]indol-7-yl)propan-2-amine |
| SMILES | Cc1[nH]c2cc3c(cc2c1CC(C)N)OCO3 |
| InChI | InChI=1S/C13H16N2O2/c1-7(14)3-9-8(2)15-11-5-13-12(4-10(9)11)16-6-17-13/h4-5,7,15H,3,6,14H2,1-2H3 |
| InChIKey | FQIHCXSWUACPIB-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 60.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.28 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|