C31H47NO3 — CID 5376134
6-methyl-7-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]-5H-[1,3]dioxolo[4,5-g]quinolin-8-one (PubChem CID 5376134) has the molecular formula C31H47NO3 and a molecular weight of 481.72 g/mol. Its IUPAC name is 6-methyl-7-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]-5H-[1,3]dioxolo[4,5-g]quinolin-8-one.
| Compound Name | 6-methyl-7-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]-5H-[1,3]dioxolo[4,5-g]quinolin-8-one |
|---|---|
| PubChem CID | 5376134 |
| Molecular Formula | C31H47NO3 |
| Molecular Weight | 481.72 g/mol |
| Exact Mass | 481.36 |
| IUPAC Name | 6-methyl-7-[(E)-3,7,11,15-tetramethylhexadec-2-enyl]-5H-[1,3]dioxolo[4,5-g]quinolin-8-one |
| SMILES | C/C(=C\Cc1c(C)[nH]c2cc3c(cc2c1=O)OCO3)CCCC(C)CCCC(C)CCCC(C)C |
| InChI | InChI=1S/C31H47NO3/c1-21(2)10-7-11-22(3)12-8-13-23(4)14-9-15-24(5)16-17-26-25(6)32-28-19-30-29(34-20-35-30)18-27(28)31(26)33/h16,18-19,21-23H,7-15,17,20H2,1-6H3,(H,32,33)/b24-16+ |
| InChIKey | QICWWCPSSJZRPJ-LFVJCYFKSA-N |
| XLogP | 8.49 |
| TPSA | 51.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.72 |
| LogP ≤ 5 | 8.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|