C16H20N2O — CID 83984565
2-methyl-3-(2-methyl-1,5,6,7-tetrahydrocyclopenta[f]indol-3-yl)propanamide (PubChem CID 83984565) has the molecular formula C16H20N2O and a molecular weight of 256.35 g/mol. Its IUPAC name is 2-methyl-3-(2-methyl-1,5,6,7-tetrahydrocyclopenta[f]indol-3-yl)propanamide.
| Compound Name | 2-methyl-3-(2-methyl-1,5,6,7-tetrahydrocyclopenta[f]indol-3-yl)propanamide |
|---|---|
| PubChem CID | 83984565 |
| Molecular Formula | C16H20N2O |
| Molecular Weight | 256.35 g/mol |
| Exact Mass | 256.16 |
| IUPAC Name | 2-methyl-3-(2-methyl-1,5,6,7-tetrahydrocyclopenta[f]indol-3-yl)propanamide |
| SMILES | Cc1[nH]c2cc3c(cc2c1CC(C)C(N)=O)CCC3 |
| InChI | InChI=1S/C16H20N2O/c1-9(16(17)19)6-13-10(2)18-15-8-12-5-3-4-11(12)7-14(13)15/h7-9,18H,3-6H2,1-2H3,(H2,17,19) |
| InChIKey | OAGAXAYJFFKGJV-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 58.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.35 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|