C25H31N3O — CID 155181348
2-methyl-3-[5-[2-(2-methyl-1H-indol-3-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]propanamide (PubChem CID 155181348) has the molecular formula C25H31N3O and a molecular weight of 389.54 g/mol. Its IUPAC name is 2-methyl-3-[5-[2-(2-methyl-1H-indol-3-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]propanamide.
| Compound Name | 2-methyl-3-[5-[2-(2-methyl-1H-indol-3-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]propanamide |
|---|---|
| PubChem CID | 155181348 |
| Molecular Formula | C25H31N3O |
| Molecular Weight | 389.54 g/mol |
| Exact Mass | 389.25 |
| IUPAC Name | 2-methyl-3-[5-[2-(2-methyl-1H-indol-3-yl)ethylamino]-5,6,7,8-tetrahydronaphthalen-2-yl]propanamide |
| SMILES | Cc1[nH]c2ccccc2c1CCNC1CCCc2cc(CC(C)C(N)=O)ccc21 |
| InChI | InChI=1S/C25H31N3O/c1-16(25(26)29)14-18-10-11-21-19(15-18)6-5-9-23(21)27-13-12-20-17(2)28-24-8-4-3-7-22(20)24/h3-4,7-8,10-11,15-16,23,27-28H,5-6,9,12-14H2,1-2H3,(H2,26,29) |
| InChIKey | KOSAPEAJXCEQMY-UHFFFAOYSA-N |
| XLogP | 4.35 |
| TPSA | 70.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.54 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'indol_3yl_alk(461)', 'substructure': 'N/A'} |
|---|