C16H7F2NO2 — CID 149338155
2,3-difluoro-5H-benzo[b]carbazole-6,11-dione (PubChem CID 149338155) has the molecular formula C16H7F2NO2 and a molecular weight of 283.23 g/mol. Its IUPAC name is 2,3-difluoro-5H-benzo[b]carbazole-6,11-dione.
| Compound Name | 2,3-difluoro-5H-benzo[b]carbazole-6,11-dione |
|---|---|
| PubChem CID | 149338155 |
| Molecular Formula | C16H7F2NO2 |
| Molecular Weight | 283.23 g/mol |
| Exact Mass | 283.04 |
| IUPAC Name | 2,3-difluoro-5H-benzo[b]carbazole-6,11-dione |
| SMILES | O=C1c2ccccc2C(=O)c2c1[nH]c1cc(F)c(F)cc21 |
| InChI | InChI=1S/C16H7F2NO2/c17-10-5-9-12(6-11(10)18)19-14-13(9)15(20)7-3-1-2-4-8(7)16(14)21/h1-6,19H |
| InChIKey | YDQOQKVQALAIFN-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 49.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.23 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|