C23H26O7 — CID 134268269
1-[2-[1-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]anthracene-9,10-dione (PubChem CID 134268269) has the molecular formula C23H26O7 and a molecular weight of 414.45 g/mol. Its IUPAC name is 1-[2-[1-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]anthracene-9,10-dione.
| Compound Name | 1-[2-[1-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]anthracene-9,10-dione |
|---|---|
| PubChem CID | 134268269 |
| Molecular Formula | C23H26O7 |
| Molecular Weight | 414.45 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | 1-[2-[1-[2-(2-methoxyethoxy)ethoxy]ethoxy]ethoxy]anthracene-9,10-dione |
| SMILES | COCCOCCOC(C)OCCOc1cccc2c1C(=O)c1ccccc1C2=O |
| InChI | InChI=1S/C23H26O7/c1-16(28-13-12-27-11-10-26-2)29-14-15-30-20-9-5-8-19-21(20)23(25)18-7-4-3-6-17(18)22(19)24/h3-9,16H,10-15H2,1-2H3 |
| InChIKey | ZCFSJOLJLPPKKU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.45 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|