C22H14N2O3 — CID 155200949
9-phenylmethoxy-6H-pyrido[4,3-b]carbazole-5,11-dione (PubChem CID 155200949) has the molecular formula C22H14N2O3 and a molecular weight of 354.37 g/mol. Its IUPAC name is 9-phenylmethoxy-6H-pyrido[4,3-b]carbazole-5,11-dione.
| Compound Name | 9-phenylmethoxy-6H-pyrido[4,3-b]carbazole-5,11-dione |
|---|---|
| PubChem CID | 155200949 |
| Molecular Formula | C22H14N2O3 |
| Molecular Weight | 354.37 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | 9-phenylmethoxy-6H-pyrido[4,3-b]carbazole-5,11-dione |
| SMILES | O=C1c2ccncc2C(=O)c2c1[nH]c1ccc(OCc3ccccc3)cc21 |
| InChI | InChI=1S/C22H14N2O3/c25-21-17-11-23-9-8-15(17)22(26)20-19(21)16-10-14(6-7-18(16)24-20)27-12-13-4-2-1-3-5-13/h1-11,24H,12H2 |
| InChIKey | AGXPQEBWQCPREE-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 72.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.37 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|