C23H15N3O4 — CID 155200894
ethyl 6-(5,11-dioxo-6H-pyrido[4,3-b]carbazol-9-yl)pyridine-2-carboxylate (PubChem CID 155200894) has the molecular formula C23H15N3O4 and a molecular weight of 397.39 g/mol. Its IUPAC name is ethyl 6-(5,11-dioxo-6H-pyrido[4,3-b]carbazol-9-yl)pyridine-2-carboxylate.
| Compound Name | ethyl 6-(5,11-dioxo-6H-pyrido[4,3-b]carbazol-9-yl)pyridine-2-carboxylate |
|---|---|
| PubChem CID | 155200894 |
| Molecular Formula | C23H15N3O4 |
| Molecular Weight | 397.39 g/mol |
| Exact Mass | 397.11 |
| IUPAC Name | ethyl 6-(5,11-dioxo-6H-pyrido[4,3-b]carbazol-9-yl)pyridine-2-carboxylate |
| SMILES | CCOC(=O)c1cccc(-c2ccc3[nH]c4c(c3c2)C(=O)c2cnccc2C4=O)n1 |
| InChI | InChI=1S/C23H15N3O4/c1-2-30-23(29)18-5-3-4-16(25-18)12-6-7-17-14(10-12)19-20(26-17)22(28)13-8-9-24-11-15(13)21(19)27/h3-11,26H,2H2,1H3 |
| InChIKey | YERQKXNJCNCYKT-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 102.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.39 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|