C33H28N2O3 — CID 67662643
5-[2-(3,5-dimethylphenyl)-5-phenylmethoxy-1H-indol-3-yl]-4-ethylisoindole-1,3-dione (PubChem CID 67662643) has the molecular formula C33H28N2O3 and a molecular weight of 500.60 g/mol. Its IUPAC name is 5-[2-(3,5-dimethylphenyl)-5-phenylmethoxy-1H-indol-3-yl]-4-ethylisoindole-1,3-dione.
| Compound Name | 5-[2-(3,5-dimethylphenyl)-5-phenylmethoxy-1H-indol-3-yl]-4-ethylisoindole-1,3-dione |
|---|---|
| PubChem CID | 67662643 |
| Molecular Formula | C33H28N2O3 |
| Molecular Weight | 500.60 g/mol |
| Exact Mass | 500.21 |
| IUPAC Name | 5-[2-(3,5-dimethylphenyl)-5-phenylmethoxy-1H-indol-3-yl]-4-ethylisoindole-1,3-dione |
| SMILES | CCc1c(-c2c(-c3cc(C)cc(C)c3)[nH]c3ccc(OCc4ccccc4)cc23)ccc2c1C(=O)NC2=O |
| InChI | InChI=1S/C33H28N2O3/c1-4-24-25(11-12-26-30(24)33(37)35-32(26)36)29-27-17-23(38-18-21-8-6-5-7-9-21)10-13-28(27)34-31(29)22-15-19(2)14-20(3)16-22/h5-17,34H,4,18H2,1-3H3,(H,35,36,37) |
| InChIKey | TVBRGAKXPJVBOE-UHFFFAOYSA-N |
| XLogP | 7.14 |
| TPSA | 71.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.60 |
| LogP ≤ 5 | 7.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|