C21H16O4 — CID 102245119
3-ethyl-8-hydroxy-6-methoxybenzo[a]anthracene-7,12-dione (PubChem CID 102245119) has the molecular formula C21H16O4 and a molecular weight of 332.36 g/mol. Its IUPAC name is 3-ethyl-8-hydroxy-6-methoxybenzo[a]anthracene-7,12-dione.
| Compound Name | 3-ethyl-8-hydroxy-6-methoxybenzo[a]anthracene-7,12-dione |
|---|---|
| PubChem CID | 102245119 |
| Molecular Formula | C21H16O4 |
| Molecular Weight | 332.36 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 3-ethyl-8-hydroxy-6-methoxybenzo[a]anthracene-7,12-dione |
| SMILES | CCc1ccc2c3c(c(OC)cc2c1)C(=O)c1c(O)cccc1C3=O |
| InChI | InChI=1S/C21H16O4/c1-3-11-7-8-13-12(9-11)10-16(25-2)19-18(13)20(23)14-5-4-6-15(22)17(14)21(19)24/h4-10,22H,3H2,1-2H3 |
| InChIKey | ZIRAYOIGGVPCHR-UHFFFAOYSA-N |
| XLogP | 3.89 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.36 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'} |
|---|