C22H18O6 — CID 71388407
8-ethyl-6,11-bis(hydroxymethoxy)tetracene-5,12-dione (PubChem CID 71388407) has the molecular formula C22H18O6 and a molecular weight of 378.38 g/mol. Its IUPAC name is 8-ethyl-6,11-bis(hydroxymethoxy)tetracene-5,12-dione.
| Compound Name | 8-ethyl-6,11-bis(hydroxymethoxy)tetracene-5,12-dione |
|---|---|
| PubChem CID | 71388407 |
| Molecular Formula | C22H18O6 |
| Molecular Weight | 378.38 g/mol |
| Exact Mass | 378.11 |
| IUPAC Name | 8-ethyl-6,11-bis(hydroxymethoxy)tetracene-5,12-dione |
| SMILES | CCc1ccc2c(OCO)c3c(c(OCO)c2c1)C(=O)c1ccccc1C3=O |
| InChI | InChI=1S/C22H18O6/c1-2-12-7-8-15-16(9-12)22(28-11-24)18-17(21(15)27-10-23)19(25)13-5-3-4-6-14(13)20(18)26/h3-9,23-24H,2,10-11H2,1H3 |
| InChIKey | PQWLHYAPXDBYDZ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 93.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.38 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|