C23H16O4 — CID 91586743
[4-(8-hydroxy-10-oxo-9-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,8,11,13-heptaenyl)phenyl] acetate (PubChem CID 91586743) has the molecular formula C23H16O4 and a molecular weight of 356.38 g/mol. Its IUPAC name is [4-(8-hydroxy-10-oxo-9-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,8,11,13-heptaenyl)phenyl] acetate.
| Compound Name | [4-(8-hydroxy-10-oxo-9-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,8,11,13-heptaenyl)phenyl] acetate |
|---|---|
| PubChem CID | 91586743 |
| Molecular Formula | C23H16O4 |
| Molecular Weight | 356.38 g/mol |
| Exact Mass | 356.10 |
| IUPAC Name | [4-(8-hydroxy-10-oxo-9-tricyclo[9.4.0.02,7]pentadeca-1(15),2,4,6,8,11,13-heptaenyl)phenyl] acetate |
| SMILES | CC(=O)Oc1ccc(-c2c(O)c3ccccc3c3ccccc3c2=O)cc1 |
| InChI | InChI=1S/C23H16O4/c1-14(24)27-16-12-10-15(11-13-16)21-22(25)19-8-4-2-6-17(19)18-7-3-5-9-20(18)23(21)26/h2-13,25H,1H3 |
| InChIKey | XFIDMKYSDRXCRN-UHFFFAOYSA-N |
| XLogP | 4.65 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.38 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|