C43H49ClGeN4O2+2 — CID 159300542
2-(chloromethyl)-9-methoxy-5,6,11-trimethylpyrido[4,3-b]carbazol-2-ium;(9-methoxy-5,6,11-trimethylpyrido[4,3-b]carbazol-2-ium-2-yl)methyl-trimethylgermane (PubChem CID 159300542) has the molecular formula C43H49ClGeN4O2+2 and a molecular weight of 761.95 g/mol. Its IUPAC name is 2-(chloromethyl)-9-methoxy-5,6,11-trimethylpyrido[4,3-b]carbazol-2-ium;(9-methoxy-5,6,11-trimethylpyrido[4,3-b]carbazol-2-ium-2-yl)methyl-trimethylgermane.
| Compound Name | 2-(chloromethyl)-9-methoxy-5,6,11-trimethylpyrido[4,3-b]carbazol-2-ium;(9-methoxy-5,6,11-trimethylpyrido[4,3-b]carbazol-2-ium-2-yl)methyl-trimethylgermane |
|---|---|
| PubChem CID | 159300542 |
| Molecular Formula | C43H49ClGeN4O2+2 |
| Molecular Weight | 761.95 g/mol |
| Exact Mass | 762.27 |
| IUPAC Name | 2-(chloromethyl)-9-methoxy-5,6,11-trimethylpyrido[4,3-b]carbazol-2-ium;(9-methoxy-5,6,11-trimethylpyrido[4,3-b]carbazol-2-ium-2-yl)methyl-trimethylgermane |
| SMILES | COc1ccc2c(c1)c1c(C)c3c[n+](CCl)ccc3c(C)c1n2C.COc1ccc2c(c1)c1c(C)c3c[n+](C[Ge](C)(C)C)ccc3c(C)c1n2C |
| InChI | InChI=1S/C23H29GeN2O.C20H20ClN2O/c1-15-20-13-26(14-24(3,4)5)11-10-18(20)16(2)23-22(15)19-12-17(27-7)8-9-21(19)25(23)6;1-12-17-10-23(11-21)8-7-15(17)13(2)20-19(12)16-9-14(24-4)5-6-18(16)22(20)3/h8-13H,14H2,1-7H3;5-10H,11H2,1-4H3/q2*+1 |
| InChIKey | UOYMBXKBNLRRJQ-UHFFFAOYSA-N |
| XLogP | 9.87 |
| TPSA | 36.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 761.95 |
| LogP ≤ 5 | 9.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|