About 4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol
4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol (PubChem CID 139089084) has the molecular formula C17H13N3O6
and a molecular weight of 355.31 g/mol. Its IUPAC name is 4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol.
Molecular Properties
| Compound Name | 4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol |
| PubChem CID | 139089084 |
| Molecular Formula | C17H13N3O6 |
| Molecular Weight | 355.31 g/mol |
| Exact Mass | 355.08 |
| IUPAC Name | 4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol |
| SMILES | O=[N+]([O-])c1cc[n+]([O-])cc1.O=[N+]([O-])c1ccc(-c2ccc(O)cc2)cc1 |
| InChI | InChI=1S/C12H9NO3.C5H4N2O3/c14-12-7-3-10(4-8-12)9-1-5-11(6-2-9)13(15)16;8-6-3-1-5(2-4-6)7(9)10/h1-8,14H;1-4H |
| InChIKey | XJTIYGKMBJZWTI-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 133.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 355.31 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'N_oxide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol?
The IUPAC name of 4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol (CID 139089084) is 4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol.
What is the SMILES notation for 4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol?
The canonical SMILES for 4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol is O=[N+]([O-])c1cc[n+]([O-])cc1.O=[N+]([O-])c1ccc(-c2ccc(O)cc2)cc1.
What is the InChIKey of 4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol?
The InChIKey is XJTIYGKMBJZWTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H9NO3.C5H4N2O3/c14-12-7-3-10(4-8-12)9-1-5-11(6-2-9)13(15)16;8-6-3-1-5(2-4-6)7(9)10/h1-8,14H;1-4H.
What are the key properties of 4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol?
4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol has a molecular weight of 355.31 g/mol, XLogP of 3.20, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-nitro-1-oxidopyridin-1-ium;4-(4-nitrophenyl)phenol is sourced from PubChem (CID 139089084), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).