C18H13F3N3S+ — CID 20608345
(2Z)-4,6,7-trifluoro-1-methyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-[1,3]thiazolo[5,4-c]pyridine (PubChem CID 20608345) has the molecular formula C18H13F3N3S+ and a molecular weight of 360.38 g/mol. Its IUPAC name is (2Z)-4,6,7-trifluoro-1-methyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-[1,3]thiazolo[5,4-c]pyridine.
| Compound Name | (2Z)-4,6,7-trifluoro-1-methyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-[1,3]thiazolo[5,4-c]pyridine |
|---|---|
| PubChem CID | 20608345 |
| Molecular Formula | C18H13F3N3S+ |
| Molecular Weight | 360.38 g/mol |
| Exact Mass | 360.08 |
| IUPAC Name | (2Z)-4,6,7-trifluoro-1-methyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-[1,3]thiazolo[5,4-c]pyridine |
| SMILES | CN1/C(=C/c2cc[n+](C)c3ccccc23)Sc2c(F)nc(F)c(F)c21 |
| InChI | InChI=1S/C18H13F3N3S/c1-23-8-7-10(11-5-3-4-6-12(11)23)9-13-24(2)15-14(19)17(20)22-18(21)16(15)25-13/h3-9H,1-2H3/q+1 |
| InChIKey | JDOFTWIYUROMHE-UHFFFAOYSA-N |
| XLogP | 4.02 |
| TPSA | 20.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.38 |
| LogP ≤ 5 | 4.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|