C23H25IN2OS — CID 134101003
(2Z)-3-ethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-7-propan-2-yloxy-1,3-benzothiazole iodide (PubChem CID 134101003) has the molecular formula C23H25IN2OS and a molecular weight of 504.44 g/mol. Its IUPAC name is (2Z)-3-ethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-7-propan-2-yloxy-1,3-benzothiazole iodide.
| Compound Name | (2Z)-3-ethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-7-propan-2-yloxy-1,3-benzothiazole iodide |
|---|---|
| PubChem CID | 134101003 |
| Molecular Formula | C23H25IN2OS |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.07 |
| IUPAC Name | (2Z)-3-ethyl-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-7-propan-2-yloxy-1,3-benzothiazole iodide |
| SMILES | CCN1/C(=C/c2cc[n+](C)c3ccccc23)Sc2c(OC(C)C)cccc21.[I-] |
| InChI | InChI=1S/C23H25N2OS.HI/c1-5-25-20-11-8-12-21(26-16(2)3)23(20)27-22(25)15-17-13-14-24(4)19-10-7-6-9-18(17)19;/h6-16H,5H2,1-4H3;1H/q+1;/p-1 |
| InChIKey | ALQMRTHLKPHVEG-UHFFFAOYSA-M |
| XLogP | 2.39 |
| TPSA | 16.35 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|