C26H24N3O4S+ — CID 87172300
(2,5-dioxopyrrolidin-1-yl) 4-[(2Z)-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]butanoate (PubChem CID 87172300) has the molecular formula C26H24N3O4S+ and a molecular weight of 474.56 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 4-[(2Z)-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]butanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 4-[(2Z)-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]butanoate |
|---|---|
| PubChem CID | 87172300 |
| Molecular Formula | C26H24N3O4S+ |
| Molecular Weight | 474.56 g/mol |
| Exact Mass | 474.15 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 4-[(2Z)-2-[(1-methylquinolin-1-ium-4-yl)methylidene]-1,3-benzothiazol-3-yl]butanoate |
| SMILES | C[n+]1ccc(/C=C2\Sc3ccccc3N2CCCC(=O)ON2C(=O)CCC2=O)c2ccccc21 |
| InChI | InChI=1S/C26H24N3O4S/c1-27-16-14-18(19-7-2-3-8-20(19)27)17-25-28(21-9-4-5-10-22(21)34-25)15-6-11-26(32)33-29-23(30)12-13-24(29)31/h2-5,7-10,14,16-17H,6,11-13,15H2,1H3/q+1 |
| InChIKey | LGIHINWLEWLHRX-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 70.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 474.56 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|