C36H38F4N3O4S+ — CID 89140875
(2,5-dioxopyrrolidin-1-yl) 6-[4,5,6,7-tetrafluoro-3-methyl-2-[3-(1-methylquinolin-1-ium-4-yl)prop-2-enylidene]-3-(4-sulfanylbutyl)indol-1-yl]hexanoate (PubChem CID 89140875) has the molecular formula C36H38F4N3O4S+ and a molecular weight of 684.78 g/mol. Its IUPAC name is (2,5-dioxopyrrolidin-1-yl) 6-[4,5,6,7-tetrafluoro-3-methyl-2-[3-(1-methylquinolin-1-ium-4-yl)prop-2-enylidene]-3-(4-sulfanylbutyl)indol-1-yl]hexanoate.
| Compound Name | (2,5-dioxopyrrolidin-1-yl) 6-[4,5,6,7-tetrafluoro-3-methyl-2-[3-(1-methylquinolin-1-ium-4-yl)prop-2-enylidene]-3-(4-sulfanylbutyl)indol-1-yl]hexanoate |
|---|---|
| PubChem CID | 89140875 |
| Molecular Formula | C36H38F4N3O4S+ |
| Molecular Weight | 684.78 g/mol |
| Exact Mass | 684.25 |
| IUPAC Name | (2,5-dioxopyrrolidin-1-yl) 6-[4,5,6,7-tetrafluoro-3-methyl-2-[3-(1-methylquinolin-1-ium-4-yl)prop-2-enylidene]-3-(4-sulfanylbutyl)indol-1-yl]hexanoate |
| SMILES | C[n+]1ccc(C=CC=C2N(CCCCCC(=O)ON3C(=O)CCC3=O)c3c(F)c(F)c(F)c(F)c3C2(C)CCCCS)c2ccccc21 |
| InChI | InChI=1S/C36H37F4N3O4S/c1-36(19-7-9-22-48)26(14-10-11-23-18-21-41(2)25-13-6-5-12-24(23)25)42(35-30(36)31(37)32(38)33(39)34(35)40)20-8-3-4-15-29(46)47-43-27(44)16-17-28(43)45/h5-6,10-14,18,21H,3-4,7-9,15-17,19-20,22H2,1-2H3/p+1 |
| InChIKey | CVLOKBPZCGLXEM-UHFFFAOYSA-O |
| XLogP | 7.16 |
| TPSA | 70.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 48 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 684.78 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|