C37H41N3O2S — CID 157430039
6-[2-[2-[4-(diethylaminomethyl)phenyl]-3-(1-methylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazol-3-yl]hexanoate (PubChem CID 157430039) has the molecular formula C37H41N3O2S and a molecular weight of 591.82 g/mol. Its IUPAC name is 6-[2-[2-[4-(diethylaminomethyl)phenyl]-3-(1-methylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazol-3-yl]hexanoate.
| Compound Name | 6-[2-[2-[4-(diethylaminomethyl)phenyl]-3-(1-methylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazol-3-yl]hexanoate |
|---|---|
| PubChem CID | 157430039 |
| Molecular Formula | C37H41N3O2S |
| Molecular Weight | 591.82 g/mol |
| Exact Mass | 591.29 |
| IUPAC Name | 6-[2-[2-[4-(diethylaminomethyl)phenyl]-3-(1-methylquinolin-1-ium-4-yl)prop-2-enylidene]-1,3-benzothiazol-3-yl]hexanoate |
| SMILES | CCN(CC)Cc1ccc(C(=Cc2cc[n+](C)c3ccccc23)C=C2Sc3ccccc3N2CCCCCC(=O)[O-])cc1 |
| InChI | InChI=1S/C37H41N3O2S/c1-4-39(5-2)27-28-18-20-29(21-19-28)31(25-30-22-24-38(3)33-14-9-8-13-32(30)33)26-36-40(23-12-6-7-17-37(41)42)34-15-10-11-16-35(34)43-36/h8-11,13-16,18-22,24-26H,4-7,12,17,23,27H2,1-3H3 |
| InChIKey | BQKNHGGANQUBLI-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 50.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.82 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|