C19H19N4O2+ — CID 23530100
(2E)-3-ethyl-2-[(E)-3-(3-ethyl-[1,3]oxazolo[4,5-b]pyridin-3-ium-2-yl)prop-2-enylidene]-[1,3]oxazolo[4,5-b]pyridine (PubChem CID 23530100) has the molecular formula C19H19N4O2+ and a molecular weight of 335.39 g/mol. Its IUPAC name is (2E)-3-ethyl-2-[(E)-3-(3-ethyl-[1,3]oxazolo[4,5-b]pyridin-3-ium-2-yl)prop-2-enylidene]-[1,3]oxazolo[4,5-b]pyridine.
| Compound Name | (2E)-3-ethyl-2-[(E)-3-(3-ethyl-[1,3]oxazolo[4,5-b]pyridin-3-ium-2-yl)prop-2-enylidene]-[1,3]oxazolo[4,5-b]pyridine |
|---|---|
| PubChem CID | 23530100 |
| Molecular Formula | C19H19N4O2+ |
| Molecular Weight | 335.39 g/mol |
| Exact Mass | 335.15 |
| IUPAC Name | (2E)-3-ethyl-2-[(E)-3-(3-ethyl-[1,3]oxazolo[4,5-b]pyridin-3-ium-2-yl)prop-2-enylidene]-[1,3]oxazolo[4,5-b]pyridine |
| SMILES | CCN1/C(=C\C=C\c2oc3cccnc3[n+]2CC)Oc2cccnc21 |
| InChI | InChI=1S/C19H19N4O2/c1-3-22-16(24-14-8-6-12-20-18(14)22)10-5-11-17-23(4-2)19-15(25-17)9-7-13-21-19/h5-13H,3-4H2,1-2H3/q+1 |
| InChIKey | RWCIRZQXQZDJGN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 55.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.39 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|