C26H30Cl2N3O4S+ — CID 90473007
4-[6-chloro-2-[(E,3E)-3-(5-chloro-3-ethyl-6-methyl-1,3-benzoxazol-2-ylidene)prop-1-enyl]-3-ethylbenzimidazol-3-ium-1-yl]butane-1-sulfonic acid (PubChem CID 90473007) has the molecular formula C26H30Cl2N3O4S+ and a molecular weight of 551.52 g/mol. Its IUPAC name is 4-[6-chloro-2-[(E,3E)-3-(5-chloro-3-ethyl-6-methyl-1,3-benzoxazol-2-ylidene)prop-1-enyl]-3-ethylbenzimidazol-3-ium-1-yl]butane-1-sulfonic acid.
| Compound Name | 4-[6-chloro-2-[(E,3E)-3-(5-chloro-3-ethyl-6-methyl-1,3-benzoxazol-2-ylidene)prop-1-enyl]-3-ethylbenzimidazol-3-ium-1-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 90473007 |
| Molecular Formula | C26H30Cl2N3O4S+ |
| Molecular Weight | 551.52 g/mol |
| Exact Mass | 550.13 |
| IUPAC Name | 4-[6-chloro-2-[(E,3E)-3-(5-chloro-3-ethyl-6-methyl-1,3-benzoxazol-2-ylidene)prop-1-enyl]-3-ethylbenzimidazol-3-ium-1-yl]butane-1-sulfonic acid |
| SMILES | CCN1/C(=C\C=C\c2n(CCCCS(=O)(=O)O)c3cc(Cl)ccc3[n+]2CC)Oc2cc(C)c(Cl)cc21 |
| InChI | InChI=1S/C26H29Cl2N3O4S/c1-4-29-21-12-11-19(27)16-22(21)31(13-6-7-14-36(32,33)34)25(29)9-8-10-26-30(5-2)23-17-20(28)18(3)15-24(23)35-26/h8-12,15-17H,4-7,13-14H2,1-3H3/p+1 |
| InChIKey | ZCDLWTHLMSJLSV-UHFFFAOYSA-O |
| XLogP | 6.01 |
| TPSA | 75.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 551.52 |
| LogP ≤ 5 | 6.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|