C27H31Cl2N2O8S2+ — CID 59904335
4-[5-chloro-2-[2-[[5-chloro-3-(3-sulfinooxypropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-6-methyl-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid (PubChem CID 59904335) has the molecular formula C27H31Cl2N2O8S2+ and a molecular weight of 646.59 g/mol. Its IUPAC name is 4-[5-chloro-2-[2-[[5-chloro-3-(3-sulfinooxypropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-6-methyl-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid.
| Compound Name | 4-[5-chloro-2-[2-[[5-chloro-3-(3-sulfinooxypropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-6-methyl-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid |
|---|---|
| PubChem CID | 59904335 |
| Molecular Formula | C27H31Cl2N2O8S2+ |
| Molecular Weight | 646.59 g/mol |
| Exact Mass | 645.09 |
| IUPAC Name | 4-[5-chloro-2-[2-[[5-chloro-3-(3-sulfinooxypropyl)-1,3-benzoxazol-2-ylidene]methyl]but-1-enyl]-6-methyl-1,3-benzoxazol-3-ium-3-yl]butane-1-sulfonic acid |
| SMILES | CCC(=Cc1oc2cc(C)c(Cl)cc2[n+]1CCCCS(=O)(=O)O)C=C1Oc2ccc(Cl)cc2N1CCCOS(=O)O |
| InChI | InChI=1S/C27H30Cl2N2O8S2/c1-3-19(14-26-31(10-6-11-37-40(32)33)22-16-20(28)7-8-24(22)38-26)15-27-30(9-4-5-12-41(34,35)36)23-17-21(29)18(2)13-25(23)39-27/h7-8,13-17H,3-6,9-12H2,1-2H3,(H-,32,33,34,35,36)/p+1 |
| InChIKey | UELQQGNBFSREFZ-UHFFFAOYSA-O |
| XLogP | 6.08 |
| TPSA | 130.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 646.59 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'sulfinic_acid', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|