C23H28N3O5S+ — CID 3947092
3-[2-(2-anilinoethenyl)-6-ethoxycarbonyl-3-ethylbenzimidazol-3-ium-1-yl]propane-1-sulfonic acid (PubChem CID 3947092) has the molecular formula C23H28N3O5S+ and a molecular weight of 458.56 g/mol. Its IUPAC name is 3-[2-(2-anilinoethenyl)-6-ethoxycarbonyl-3-ethylbenzimidazol-3-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-(2-anilinoethenyl)-6-ethoxycarbonyl-3-ethylbenzimidazol-3-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 3947092 |
| Molecular Formula | C23H28N3O5S+ |
| Molecular Weight | 458.56 g/mol |
| Exact Mass | 458.17 |
| IUPAC Name | 3-[2-(2-anilinoethenyl)-6-ethoxycarbonyl-3-ethylbenzimidazol-3-ium-1-yl]propane-1-sulfonic acid |
| SMILES | CCOC(=O)c1ccc2c(c1)n(CCCS(=O)(=O)O)c(C=CNc1ccccc1)[n+]2CC |
| InChI | InChI=1S/C23H27N3O5S/c1-3-25-20-12-11-18(23(27)31-4-2)17-21(20)26(15-8-16-32(28,29)30)22(25)13-14-24-19-9-6-5-7-10-19/h5-7,9-14,17H,3-4,8,15-16H2,1-2H3,(H,28,29,30)/p+1 |
| InChIKey | QYYOXVGTDKMPMR-UHFFFAOYSA-O |
| XLogP | 3.49 |
| TPSA | 101.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.56 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|