C31H37N4O7S+ — CID 59937748
3-[2-[(1E,3E,5Z)-5-(1-ethenyl-3-ethyl-5-methoxycarbonylbenzimidazol-2-ylidene)penta-1,3-dienyl]-3-methyl-6-(methylperoxymethyl)benzimidazol-3-ium-1-yl]propane-1-sulfonic acid (PubChem CID 59937748) has the molecular formula C31H37N4O7S+ and a molecular weight of 609.73 g/mol. Its IUPAC name is 3-[2-[(1E,3E,5Z)-5-(1-ethenyl-3-ethyl-5-methoxycarbonylbenzimidazol-2-ylidene)penta-1,3-dienyl]-3-methyl-6-(methylperoxymethyl)benzimidazol-3-ium-1-yl]propane-1-sulfonic acid.
| Compound Name | 3-[2-[(1E,3E,5Z)-5-(1-ethenyl-3-ethyl-5-methoxycarbonylbenzimidazol-2-ylidene)penta-1,3-dienyl]-3-methyl-6-(methylperoxymethyl)benzimidazol-3-ium-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59937748 |
| Molecular Formula | C31H37N4O7S+ |
| Molecular Weight | 609.73 g/mol |
| Exact Mass | 609.24 |
| IUPAC Name | 3-[2-[(1E,3E,5Z)-5-(1-ethenyl-3-ethyl-5-methoxycarbonylbenzimidazol-2-ylidene)penta-1,3-dienyl]-3-methyl-6-(methylperoxymethyl)benzimidazol-3-ium-1-yl]propane-1-sulfonic acid |
| SMILES | C=CN1/C(=C\C=C\C=C\c2n(CCCS(=O)(=O)O)c3cc(COOC)ccc3[n+]2C)N(CC)c2cc(C(=O)OC)ccc21 |
| InChI | InChI=1S/C31H36N4O7S/c1-6-33-26-17-15-24(31(36)40-4)21-28(26)34(7-2)30(33)13-10-8-9-12-29-32(3)25-16-14-23(22-42-41-5)20-27(25)35(29)18-11-19-43(37,38)39/h6,8-10,12-17,20-21H,1,7,11,18-19,22H2,2-5H3/p+1 |
| InChIKey | WDGLWLIHOTWWBH-UHFFFAOYSA-O |
| XLogP | 4.51 |
| TPSA | 114.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 609.73 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|