C28H31Cl4N3O6S2 — CID 20714906
3-[5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-ethyl-3-(3-sulfopropyl)benzimidazol-2-ylidene]prop-1-enyl]-1-ethylindol-3-yl]propane-1-sulfonic acid (PubChem CID 20714906) has the molecular formula C28H31Cl4N3O6S2 and a molecular weight of 711.52 g/mol. Its IUPAC name is 3-[5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-ethyl-3-(3-sulfopropyl)benzimidazol-2-ylidene]prop-1-enyl]-1-ethylindol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-ethyl-3-(3-sulfopropyl)benzimidazol-2-ylidene]prop-1-enyl]-1-ethylindol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 20714906 |
| Molecular Formula | C28H31Cl4N3O6S2 |
| Molecular Weight | 711.52 g/mol |
| Exact Mass | 709.04 |
| IUPAC Name | 3-[5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-ethyl-3-(3-sulfopropyl)benzimidazol-2-ylidene]prop-1-enyl]-1-ethylindol-3-yl]propane-1-sulfonic acid |
| SMILES | CCN1/C(=C/C=C/c2c(CCCS(=O)(=O)O)c3cc(Cl)c(Cl)cc3n2CC)N(CCCS(=O)(=O)O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C28H31Cl4N3O6S2/c1-3-33-24(18(8-6-12-42(36,37)38)19-14-20(29)21(30)15-25(19)33)9-5-10-28-34(4-2)26-16-22(31)23(32)17-27(26)35(28)11-7-13-43(39,40)41/h5,9-10,14-17H,3-4,6-8,11-13H2,1-2H3,(H,36,37,38)(H,39,40,41)/b9-5+,28-10- |
| InChIKey | DGYPMCRIOJPJAL-MZRNJGACSA-N |
| XLogP | 7.57 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 711.52 |
| LogP ≤ 5 | 7.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|