C30H35Cl4N3O6S2 — CID 59891548
3-[5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-propyl-3-(3-sulfopropyl)benzimidazol-2-ylidene]prop-1-enyl]-1-propylindol-3-yl]propane-1-sulfonic acid (PubChem CID 59891548) has the molecular formula C30H35Cl4N3O6S2 and a molecular weight of 739.57 g/mol. Its IUPAC name is 3-[5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-propyl-3-(3-sulfopropyl)benzimidazol-2-ylidene]prop-1-enyl]-1-propylindol-3-yl]propane-1-sulfonic acid.
| Compound Name | 3-[5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-propyl-3-(3-sulfopropyl)benzimidazol-2-ylidene]prop-1-enyl]-1-propylindol-3-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59891548 |
| Molecular Formula | C30H35Cl4N3O6S2 |
| Molecular Weight | 739.57 g/mol |
| Exact Mass | 737.07 |
| IUPAC Name | 3-[5,6-dichloro-2-[(E,3Z)-3-[5,6-dichloro-1-propyl-3-(3-sulfopropyl)benzimidazol-2-ylidene]prop-1-enyl]-1-propylindol-3-yl]propane-1-sulfonic acid |
| SMILES | CCCN1/C(=C/C=C/c2c(CCCS(=O)(=O)O)c3cc(Cl)c(Cl)cc3n2CCC)N(CCCS(=O)(=O)O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C30H35Cl4N3O6S2/c1-3-11-35-26(20(8-6-14-44(38,39)40)21-16-22(31)23(32)17-27(21)35)9-5-10-30-36(12-4-2)28-18-24(33)25(34)19-29(28)37(30)13-7-15-45(41,42)43/h5,9-10,16-19H,3-4,6-8,11-15H2,1-2H3,(H,38,39,40)(H,41,42,43)/b9-5+,30-10- |
| InChIKey | CHIAJNOYJSZZFL-WEROKWOCSA-N |
| XLogP | 8.35 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 739.57 |
| LogP ≤ 5 | 8.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|