C22H19Cl4N3O6S2 — CID 59876828
[5,6-dichloro-2-[(E,3E)-3-[5,6-dichloro-1-methyl-3-(sulfomethyl)benzimidazol-2-ylidene]prop-1-enyl]-1-methylindol-3-yl]methanesulfonic acid (PubChem CID 59876828) has the molecular formula C22H19Cl4N3O6S2 and a molecular weight of 627.36 g/mol. Its IUPAC name is [5,6-dichloro-2-[(E,3E)-3-[5,6-dichloro-1-methyl-3-(sulfomethyl)benzimidazol-2-ylidene]prop-1-enyl]-1-methylindol-3-yl]methanesulfonic acid.
| Compound Name | [5,6-dichloro-2-[(E,3E)-3-[5,6-dichloro-1-methyl-3-(sulfomethyl)benzimidazol-2-ylidene]prop-1-enyl]-1-methylindol-3-yl]methanesulfonic acid |
|---|---|
| PubChem CID | 59876828 |
| Molecular Formula | C22H19Cl4N3O6S2 |
| Molecular Weight | 627.36 g/mol |
| Exact Mass | 624.95 |
| IUPAC Name | [5,6-dichloro-2-[(E,3E)-3-[5,6-dichloro-1-methyl-3-(sulfomethyl)benzimidazol-2-ylidene]prop-1-enyl]-1-methylindol-3-yl]methanesulfonic acid |
| SMILES | CN1/C(=C\C=C\c2c(CS(=O)(=O)O)c3cc(Cl)c(Cl)cc3n2C)N(CS(=O)(=O)O)c2cc(Cl)c(Cl)cc21 |
| InChI | InChI=1S/C22H19Cl4N3O6S2/c1-27-18(13(10-36(30,31)32)12-6-14(23)15(24)7-19(12)27)4-3-5-22-28(2)20-8-16(25)17(26)9-21(20)29(22)11-37(33,34)35/h3-9H,10-11H2,1-2H3,(H,30,31,32)(H,33,34,35)/b4-3+,22-5+ |
| InChIKey | AOHDJTPZBGXSLO-BRTCCXBPSA-N |
| XLogP | 5.84 |
| TPSA | 120.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 627.36 |
| LogP ≤ 5 | 5.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|