C22H30N3O3+ — CID 58058178
2-[(E)-[1-(2-cyclopentylethyl)-3,3-dimethyl-5-nitroindol-2-ylidene]methyl]-3-methyl-4,5-dihydro-1,3-oxazol-3-ium (PubChem CID 58058178) has the molecular formula C22H30N3O3+ and a molecular weight of 384.50 g/mol. Its IUPAC name is 2-[(E)-[1-(2-cyclopentylethyl)-3,3-dimethyl-5-nitroindol-2-ylidene]methyl]-3-methyl-4,5-dihydro-1,3-oxazol-3-ium.
| Compound Name | 2-[(E)-[1-(2-cyclopentylethyl)-3,3-dimethyl-5-nitroindol-2-ylidene]methyl]-3-methyl-4,5-dihydro-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 58058178 |
| Molecular Formula | C22H30N3O3+ |
| Molecular Weight | 384.50 g/mol |
| Exact Mass | 384.23 |
| IUPAC Name | 2-[(E)-[1-(2-cyclopentylethyl)-3,3-dimethyl-5-nitroindol-2-ylidene]methyl]-3-methyl-4,5-dihydro-1,3-oxazol-3-ium |
| SMILES | C[N+]1=C(/C=C2/N(CCC3CCCC3)c3ccc([N+](=O)[O-])cc3C2(C)C)OCC1 |
| InChI | InChI=1S/C22H30N3O3/c1-22(2)18-14-17(25(26)27)8-9-19(18)24(11-10-16-6-4-5-7-16)20(22)15-21-23(3)12-13-28-21/h8-9,14-16H,4-7,10-13H2,1-3H3/q+1 |
| InChIKey | HCMSUHLSFDPFQA-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 58.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|