C34H42N3O2+ — CID 123957161
1-(4-tert-butylcyclohex-3-en-1-yl)-3,3-dimethyl-5-nitro-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole (PubChem CID 123957161) has the molecular formula C34H42N3O2+ and a molecular weight of 524.73 g/mol. Its IUPAC name is 1-(4-tert-butylcyclohex-3-en-1-yl)-3,3-dimethyl-5-nitro-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole.
| Compound Name | 1-(4-tert-butylcyclohex-3-en-1-yl)-3,3-dimethyl-5-nitro-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole |
|---|---|
| PubChem CID | 123957161 |
| Molecular Formula | C34H42N3O2+ |
| Molecular Weight | 524.73 g/mol |
| Exact Mass | 524.33 |
| IUPAC Name | 1-(4-tert-butylcyclohex-3-en-1-yl)-3,3-dimethyl-5-nitro-2-[3-(1,3,3-trimethylindol-1-ium-2-yl)prop-2-enylidene]indole |
| SMILES | C[N+]1=C(C=CC=C2N(C3CC=C(C(C)(C)C)CC3)c3ccc([N+](=O)[O-])cc3C2(C)C)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C34H42N3O2/c1-32(2,3)23-16-18-24(19-17-23)36-29-21-20-25(37(38)39)22-27(29)34(6,7)31(36)15-11-14-30-33(4,5)26-12-9-10-13-28(26)35(30)8/h9-16,20-22,24H,17-19H2,1-8H3/q+1 |
| InChIKey | YQFJULCHDKWQNL-UHFFFAOYSA-N |
| XLogP | 8.36 |
| TPSA | 49.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.73 |
| LogP ≤ 5 | 8.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'dyes5A(27)', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|