C20H27N2S+ — CID 76689794
3-ethyl-2-[3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-4,5-dihydro-1,3-thiazol-3-ium (PubChem CID 76689794) has the molecular formula C20H27N2S+ and a molecular weight of 327.52 g/mol. Its IUPAC name is 3-ethyl-2-[3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-4,5-dihydro-1,3-thiazol-3-ium.
| Compound Name | 3-ethyl-2-[3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-4,5-dihydro-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 76689794 |
| Molecular Formula | C20H27N2S+ |
| Molecular Weight | 327.52 g/mol |
| Exact Mass | 327.19 |
| IUPAC Name | 3-ethyl-2-[3-(1-ethyl-3,3-dimethylindol-2-ylidene)prop-1-enyl]-4,5-dihydro-1,3-thiazol-3-ium |
| SMILES | CCN1C(=CC=CC2=[N+](CC)CCS2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C20H27N2S/c1-5-21-14-15-23-19(21)13-9-12-18-20(3,4)16-10-7-8-11-17(16)22(18)6-2/h7-13H,5-6,14-15H2,1-4H3/q+1 |
| InChIKey | YYHIZQVOSSQFPN-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 6.25 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.52 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|