C37H47IN4S — CID 174060169
(2E)-1-ethyl-2-[(2Z)-2-[5-[2-(1-ethyl-3,3-dimethylindol-2-ylidene)ethylidene]-4-piperazin-1-ium-1-ylidenethian-3-ylidene]ethylidene]-3,3-dimethylindole iodide (PubChem CID 174060169) has the molecular formula C37H47IN4S and a molecular weight of 706.78 g/mol. Its IUPAC name is (2E)-1-ethyl-2-[(2Z)-2-[5-[2-(1-ethyl-3,3-dimethylindol-2-ylidene)ethylidene]-4-piperazin-1-ium-1-ylidenethian-3-ylidene]ethylidene]-3,3-dimethylindole iodide.
| Compound Name | (2E)-1-ethyl-2-[(2Z)-2-[5-[2-(1-ethyl-3,3-dimethylindol-2-ylidene)ethylidene]-4-piperazin-1-ium-1-ylidenethian-3-ylidene]ethylidene]-3,3-dimethylindole iodide |
|---|---|
| PubChem CID | 174060169 |
| Molecular Formula | C37H47IN4S |
| Molecular Weight | 706.78 g/mol |
| Exact Mass | 706.26 |
| IUPAC Name | (2E)-1-ethyl-2-[(2Z)-2-[5-[2-(1-ethyl-3,3-dimethylindol-2-ylidene)ethylidene]-4-piperazin-1-ium-1-ylidenethian-3-ylidene]ethylidene]-3,3-dimethylindole iodide |
| SMILES | CCN1C(=CC=C2CSC/C(=C\C=C3\N(CC)c4ccccc4C3(C)C)C2=[N+]2CCNCC2)C(C)(C)c2ccccc21.[I-] |
| InChI | InChI=1S/C37H47N4S.HI/c1-7-40-31-15-11-9-13-29(31)36(3,4)33(40)19-17-27-25-42-26-28(35(27)39-23-21-38-22-24-39)18-20-34-37(5,6)30-14-10-12-16-32(30)41(34)8-2;/h9-20,38H,7-8,21-26H2,1-6H3;1H/q+1;/p-1 |
| InChIKey | WTVBGGKCDLVXFX-UHFFFAOYSA-M |
| XLogP | 4.05 |
| TPSA | 21.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 43 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 706.78 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'ene_one_ene_A(57)', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|