C21H29N2O+ — CID 76689784
2-[3-(3,3-dimethyl-1-propylindol-2-ylidene)prop-1-enyl]-3-ethyl-4,5-dihydro-1,3-oxazol-3-ium (PubChem CID 76689784) has the molecular formula C21H29N2O+ and a molecular weight of 325.48 g/mol. Its IUPAC name is 2-[3-(3,3-dimethyl-1-propylindol-2-ylidene)prop-1-enyl]-3-ethyl-4,5-dihydro-1,3-oxazol-3-ium.
| Compound Name | 2-[3-(3,3-dimethyl-1-propylindol-2-ylidene)prop-1-enyl]-3-ethyl-4,5-dihydro-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 76689784 |
| Molecular Formula | C21H29N2O+ |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.23 |
| IUPAC Name | 2-[3-(3,3-dimethyl-1-propylindol-2-ylidene)prop-1-enyl]-3-ethyl-4,5-dihydro-1,3-oxazol-3-ium |
| SMILES | CCCN1C(=CC=CC2=[N+](CC)CCO2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C21H29N2O/c1-5-14-23-18-11-8-7-10-17(18)21(3,4)19(23)12-9-13-20-22(6-2)15-16-24-20/h7-13H,5-6,14-16H2,1-4H3/q+1 |
| InChIKey | YASGQEZZEVYDSP-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|