C25H30ClN2O+ — CID 58058159
2-[(E)-(3-benzyl-5-chloro-3-methyl-1-propylindol-2-ylidene)methyl]-3-ethyl-4,5-dihydro-1,3-oxazol-3-ium (PubChem CID 58058159) has the molecular formula C25H30ClN2O+ and a molecular weight of 409.98 g/mol. Its IUPAC name is 2-[(E)-(3-benzyl-5-chloro-3-methyl-1-propylindol-2-ylidene)methyl]-3-ethyl-4,5-dihydro-1,3-oxazol-3-ium.
| Compound Name | 2-[(E)-(3-benzyl-5-chloro-3-methyl-1-propylindol-2-ylidene)methyl]-3-ethyl-4,5-dihydro-1,3-oxazol-3-ium |
|---|---|
| PubChem CID | 58058159 |
| Molecular Formula | C25H30ClN2O+ |
| Molecular Weight | 409.98 g/mol |
| Exact Mass | 409.20 |
| IUPAC Name | 2-[(E)-(3-benzyl-5-chloro-3-methyl-1-propylindol-2-ylidene)methyl]-3-ethyl-4,5-dihydro-1,3-oxazol-3-ium |
| SMILES | CCCN1/C(=C/C2=[N+](CC)CCO2)C(C)(Cc2ccccc2)c2cc(Cl)ccc21 |
| InChI | InChI=1S/C25H30ClN2O/c1-4-13-28-22-12-11-20(26)16-21(22)25(3,18-19-9-7-6-8-10-19)23(28)17-24-27(5-2)14-15-29-24/h6-12,16-17H,4-5,13-15,18H2,1-3H3/q+1 |
| InChIKey | IMBIGCHMCOLAQM-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 15.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 409.98 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|