C36H48N3O+ — CID 159893679
2-[5-ethyl-2-[7-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]-N,N-dimethylpropan-1-amine (PubChem CID 159893679) has the molecular formula C36H48N3O+ and a molecular weight of 538.80 g/mol. Its IUPAC name is 2-[5-ethyl-2-[7-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]-N,N-dimethylpropan-1-amine.
| Compound Name | 2-[5-ethyl-2-[7-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]-N,N-dimethylpropan-1-amine |
|---|---|
| PubChem CID | 159893679 |
| Molecular Formula | C36H48N3O+ |
| Molecular Weight | 538.80 g/mol |
| Exact Mass | 538.38 |
| IUPAC Name | 2-[5-ethyl-2-[7-(5-methoxy-1,3,3-trimethylindol-1-ium-2-yl)hepta-2,4,6-trienylidene]-3,3-dimethylindol-1-yl]-N,N-dimethylpropan-1-amine |
| SMILES | CCc1ccc2c(c1)C(C)(C)C(=CC=CC=CC=CC1=[N+](C)c3ccc(OC)cc3C1(C)C)N2C(C)CN(C)C |
| InChI | InChI=1S/C36H48N3O/c1-11-27-19-21-32-29(23-27)36(5,6)34(39(32)26(2)25-37(7)8)18-16-14-12-13-15-17-33-35(3,4)30-24-28(40-10)20-22-31(30)38(33)9/h12-24,26H,11,25H2,1-10H3/q+1 |
| InChIKey | NVBOIYAJLKOFSB-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 18.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.80 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|