C36H49CsN3O11+ — CID 177494849
cesium 2-[(E)-2-[1-[2-(1,4,7,10,13,16,19-heptaoxa-22-azacyclotetracos-22-yl)-2-oxoethyl]-3,3-dimethylindol-1-ium-2-yl]ethenyl]-4-nitrophenolate (PubChem CID 177494849) has the molecular formula C36H49CsN3O11+ and a molecular weight of 832.70 g/mol. Its IUPAC name is cesium 2-[(E)-2-[1-[2-(1,4,7,10,13,16,19-heptaoxa-22-azacyclotetracos-22-yl)-2-oxoethyl]-3,3-dimethylindol-1-ium-2-yl]ethenyl]-4-nitrophenolate.
| Compound Name | cesium 2-[(E)-2-[1-[2-(1,4,7,10,13,16,19-heptaoxa-22-azacyclotetracos-22-yl)-2-oxoethyl]-3,3-dimethylindol-1-ium-2-yl]ethenyl]-4-nitrophenolate |
|---|---|
| PubChem CID | 177494849 |
| Molecular Formula | C36H49CsN3O11+ |
| Molecular Weight | 832.70 g/mol |
| Exact Mass | 832.24 |
| IUPAC Name | cesium 2-[(E)-2-[1-[2-(1,4,7,10,13,16,19-heptaoxa-22-azacyclotetracos-22-yl)-2-oxoethyl]-3,3-dimethylindol-1-ium-2-yl]ethenyl]-4-nitrophenolate |
| SMILES | CC1(C)C(/C=C/c2cc([N+](=O)[O-])ccc2[O-])=[N+](CC(=O)N2CCOCCOCCOCCOCCOCCOCCOCC2)c2ccccc21.[Cs+] |
| InChI | InChI=1S/C36H49N3O11.Cs/c1-36(2)31-5-3-4-6-32(31)38(34(36)10-7-29-27-30(39(42)43)8-9-33(29)40)28-35(41)37-11-13-44-15-17-46-19-21-48-23-25-50-26-24-49-22-20-47-18-16-45-14-12-37;/h3-10,27H,11-26,28H2,1-2H3;/q;+1 |
| InChIKey | MYDMVSAVWWWPQQ-UHFFFAOYSA-N |
| XLogP | -0.28 |
| TPSA | 154.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 832.70 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|