C42H62N3O7+ — CID 163685178
8-amino-2-tert-butyl-7-ethyl-6-[2-[2-[(E)-2-(2-hydroxy-5-nitrophenyl)ethenyl]-3,3-dimethylindol-1-ium-1-yl]ethoxycarbonyl]-3,3,5,5,6,7-hexamethylnonanoic acid (PubChem CID 163685178) has the molecular formula C42H62N3O7+ and a molecular weight of 720.97 g/mol. Its IUPAC name is 8-amino-2-tert-butyl-7-ethyl-6-[2-[2-[(E)-2-(2-hydroxy-5-nitrophenyl)ethenyl]-3,3-dimethylindol-1-ium-1-yl]ethoxycarbonyl]-3,3,5,5,6,7-hexamethylnonanoic acid.
| Compound Name | 8-amino-2-tert-butyl-7-ethyl-6-[2-[2-[(E)-2-(2-hydroxy-5-nitrophenyl)ethenyl]-3,3-dimethylindol-1-ium-1-yl]ethoxycarbonyl]-3,3,5,5,6,7-hexamethylnonanoic acid |
|---|---|
| PubChem CID | 163685178 |
| Molecular Formula | C42H62N3O7+ |
| Molecular Weight | 720.97 g/mol |
| Exact Mass | 720.46 |
| IUPAC Name | 8-amino-2-tert-butyl-7-ethyl-6-[2-[2-[(E)-2-(2-hydroxy-5-nitrophenyl)ethenyl]-3,3-dimethylindol-1-ium-1-yl]ethoxycarbonyl]-3,3,5,5,6,7-hexamethylnonanoic acid |
| SMILES | CCC(C)(C(C)N)C(C)(C(=O)OCC[N+]1=C(/C=C/c2cc([N+](=O)[O-])ccc2O)C(C)(C)c2ccccc21)C(C)(C)CC(C)(C)C(C(=O)O)C(C)(C)C |
| InChI | InChI=1S/C42H61N3O7/c1-14-41(12,27(2)43)42(13,39(8,9)26-38(6,7)34(35(47)48)37(3,4)5)36(49)52-24-23-44-31-18-16-15-17-30(31)40(10,11)33(44)22-19-28-25-29(45(50)51)20-21-32(28)46/h15-22,25,27,34H,14,23-24,26,43H2,1-13H3,(H,47,48)/p+1 |
| InChIKey | JOGCFUWWZFJJKS-UHFFFAOYSA-O |
| XLogP | 8.89 |
| TPSA | 156.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 720.97 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|