C35H42N3O13S3+ — CID 163956746
2-[5-[4-formyl-3,3-dimethyl-1-(2-sulfoethyl)-6-(2-sulfoethylcarbamoyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-4-carboxylic acid (PubChem CID 163956746) has the molecular formula C35H42N3O13S3+ and a molecular weight of 808.93 g/mol. Its IUPAC name is 2-[5-[4-formyl-3,3-dimethyl-1-(2-sulfoethyl)-6-(2-sulfoethylcarbamoyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-4-carboxylic acid.
| Compound Name | 2-[5-[4-formyl-3,3-dimethyl-1-(2-sulfoethyl)-6-(2-sulfoethylcarbamoyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 163956746 |
| Molecular Formula | C35H42N3O13S3+ |
| Molecular Weight | 808.93 g/mol |
| Exact Mass | 808.19 |
| IUPAC Name | 2-[5-[4-formyl-3,3-dimethyl-1-(2-sulfoethyl)-6-(2-sulfoethylcarbamoyl)indol-2-ylidene]penta-1,3-dienyl]-3,3-dimethyl-1-(3-sulfopropyl)indol-1-ium-4-carboxylic acid |
| SMILES | CC1(C)C(=CC=CC=CC2=[N+](CCCS(=O)(=O)O)c3cccc(C(=O)O)c3C2(C)C)N(CCS(=O)(=O)O)c2cc(C(=O)NCCS(=O)(=O)O)cc(C=O)c21 |
| InChI | InChI=1S/C35H41N3O13S3/c1-34(2)28(38(16-19-54(49,50)51)27-21-23(20-24(22-39)30(27)34)32(40)36-14-18-53(46,47)48)12-6-5-7-13-29-35(3,4)31-25(33(41)42)10-8-11-26(31)37(29)15-9-17-52(43,44)45/h5-8,10-13,20-22H,9,14-19H2,1-4H3,(H4-,36,40,41,42,43,44,45,46,47,48,49,50,51)/p+1 |
| InChIKey | SEAIILMZBBUVEN-UHFFFAOYSA-O |
| XLogP | 3.15 |
| TPSA | 252.83 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 54 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 808.93 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|