C24H26NNaO6S2 — CID 59894138
sodium 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3,3-dimethyl-5-oxidoperoxysulfanylinden-1-yl]propane-1-sulfonic acid (PubChem CID 59894138) has the molecular formula C24H26NNaO6S2 and a molecular weight of 511.60 g/mol. Its IUPAC name is sodium 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3,3-dimethyl-5-oxidoperoxysulfanylinden-1-yl]propane-1-sulfonic acid.
| Compound Name | sodium 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3,3-dimethyl-5-oxidoperoxysulfanylinden-1-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 59894138 |
| Molecular Formula | C24H26NNaO6S2 |
| Molecular Weight | 511.60 g/mol |
| Exact Mass | 511.11 |
| IUPAC Name | sodium 3-[2-[(1E,3E)-4-anilinobuta-1,3-dienyl]-3,3-dimethyl-5-oxidoperoxysulfanylinden-1-yl]propane-1-sulfonic acid |
| SMILES | CC1(C)C(/C=C/C=C/Nc2ccccc2)=C(CCCS(=O)(=O)O)c2ccc(SOO[O-])cc21.[Na+] |
| InChI | InChI=1S/C24H27NO6S2.Na/c1-24(2)22(12-6-7-15-25-18-9-4-3-5-10-18)20(11-8-16-33(27,28)29)21-14-13-19(17-23(21)24)32-31-30-26;/h3-7,9-10,12-15,17,25-26H,8,11,16H2,1-2H3,(H,27,28,29);/q;+1/p-1/b12-6+,15-7+; |
| InChIKey | ZNKBMVDJWFJUDY-DIFVGCTESA-M |
| XLogP | 1.82 |
| TPSA | 107.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.60 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'}, {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|