C28H34N2O4S — CID 160565163
3-[4-[(1E,3E)-4-anilinobuta-1,3-dienyl]-2-(3,3-dimethylbutylimino)chromen-7-yl]propane-1-sulfonic acid (PubChem CID 160565163) has the molecular formula C28H34N2O4S and a molecular weight of 494.66 g/mol. Its IUPAC name is 3-[4-[(1E,3E)-4-anilinobuta-1,3-dienyl]-2-(3,3-dimethylbutylimino)chromen-7-yl]propane-1-sulfonic acid.
| Compound Name | 3-[4-[(1E,3E)-4-anilinobuta-1,3-dienyl]-2-(3,3-dimethylbutylimino)chromen-7-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 160565163 |
| Molecular Formula | C28H34N2O4S |
| Molecular Weight | 494.66 g/mol |
| Exact Mass | 494.22 |
| IUPAC Name | 3-[4-[(1E,3E)-4-anilinobuta-1,3-dienyl]-2-(3,3-dimethylbutylimino)chromen-7-yl]propane-1-sulfonic acid |
| SMILES | CC(C)(C)CC/N=c1/cc(/C=C/C=C/Nc2ccccc2)c2ccc(CCCS(=O)(=O)O)cc2o1 |
| InChI | InChI=1S/C28H34N2O4S/c1-28(2,3)16-18-30-27-21-23(11-7-8-17-29-24-12-5-4-6-13-24)25-15-14-22(20-26(25)34-27)10-9-19-35(31,32)33/h4-8,11-15,17,20-21,29H,9-10,16,18-19H2,1-3H3,(H,31,32,33)/b11-7+,17-8+,30-27- |
| InChIKey | AZXTUGKLSXDGNN-LVCYHRSSSA-N |
| XLogP | 6.23 |
| TPSA | 91.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.66 |
| LogP ≤ 5 | 6.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|