C29H36N2O7S2 — CID 173115695
3-[4-(4-anilinobuta-1,3-dienyl)-2-tert-butyl-7-imino-3-(3-sulfopropyl)chromen-5-yl]propane-1-sulfonic acid (PubChem CID 173115695) has the molecular formula C29H36N2O7S2 and a molecular weight of 588.75 g/mol. Its IUPAC name is 3-[4-(4-anilinobuta-1,3-dienyl)-2-tert-butyl-7-imino-3-(3-sulfopropyl)chromen-5-yl]propane-1-sulfonic acid.
| Compound Name | 3-[4-(4-anilinobuta-1,3-dienyl)-2-tert-butyl-7-imino-3-(3-sulfopropyl)chromen-5-yl]propane-1-sulfonic acid |
|---|---|
| PubChem CID | 173115695 |
| Molecular Formula | C29H36N2O7S2 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.20 |
| IUPAC Name | 3-[4-(4-anilinobuta-1,3-dienyl)-2-tert-butyl-7-imino-3-(3-sulfopropyl)chromen-5-yl]propane-1-sulfonic acid |
| SMILES | [H]/N=c1/cc2oc(C(C)(C)C)c(CCCS(=O)(=O)O)c(C=CC=CNc3ccccc3)c-2c(CCCS(=O)(=O)O)c1 |
| InChI | InChI=1S/C29H36N2O7S2/c1-29(2,3)28-25(15-10-18-40(35,36)37)24(14-7-8-16-31-23-12-5-4-6-13-23)27-21(11-9-17-39(32,33)34)19-22(30)20-26(27)38-28/h4-8,12-14,16,19-20,30-31H,9-11,15,17-18H2,1-3H3,(H,32,33,34)(H,35,36,37)/b14-7?,16-8?,30-22+ |
| InChIKey | PCCAQHISUNHIAO-CMBLKXNJSA-N |
| XLogP | 5.44 |
| TPSA | 157.76 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|