C29H37N3O5+2 — CID 132941594
[1-carboxy-4-[4-[2-[1-(4-ethoxy-4-oxobutyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]anilino]-4-oxobutyl]azanium (PubChem CID 132941594) has the molecular formula C29H37N3O5+2 and a molecular weight of 507.63 g/mol. Its IUPAC name is [1-carboxy-4-[4-[2-[1-(4-ethoxy-4-oxobutyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]anilino]-4-oxobutyl]azanium.
| Compound Name | [1-carboxy-4-[4-[2-[1-(4-ethoxy-4-oxobutyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]anilino]-4-oxobutyl]azanium |
|---|---|
| PubChem CID | 132941594 |
| Molecular Formula | C29H37N3O5+2 |
| Molecular Weight | 507.63 g/mol |
| Exact Mass | 507.27 |
| IUPAC Name | [1-carboxy-4-[4-[2-[1-(4-ethoxy-4-oxobutyl)-3,3-dimethylindol-1-ium-2-yl]ethenyl]anilino]-4-oxobutyl]azanium |
| SMILES | CCOC(=O)CCC[N+]1=C(C=Cc2ccc(NC(=O)CCC([NH3+])C(=O)O)cc2)C(C)(C)c2ccccc21 |
| InChI | InChI=1S/C29H35N3O5/c1-4-37-27(34)10-7-19-32-24-9-6-5-8-22(24)29(2,3)25(32)17-13-20-11-14-21(15-12-20)31-26(33)18-16-23(30)28(35)36/h5-6,8-9,11-15,17,23H,4,7,10,16,18-19,30H2,1-3H3,(H,35,36)/p+2 |
| InChIKey | AZJRZKNGVODIPC-UHFFFAOYSA-P |
| XLogP | 3.53 |
| TPSA | 123.35 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.63 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|